![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | Metric Space/ | 2010-09-05 18:22 | - | |
![[ ]](/icons/unknown.gif) | Quantitative topology course Fall 2010.doc | 2010-09-05 18:22 | 61K | |
![[ ]](/icons/layout.gif) | chazal-lieutier, crit point.pdf | 2010-09-05 18:21 | 148K | |
![[ ]](/icons/layout.gif) | counting hyperbolic manifolds.pdf | 2010-09-05 18:21 | 173K | |
![[ ]](/icons/layout.gif) | Guth, Gromov filling inequality.pdf | 2010-09-05 18:22 | 231K | |
![[ ]](/icons/layout.gif) | MW immersions.pdf | 2018-12-08 17:48 | 322K | |
![[ ]](/icons/layout.gif) | Guthsystmet.pdf | 2010-09-07 15:48 | 409K | |
![[ ]](/icons/layout.gif) | Yomdin, Topology paper.pdf | 2010-09-07 15:49 | 459K | |
![[ ]](/icons/layout.gif) | shadows.pdf | 2018-03-19 11:27 | 467K | |
![[ ]](/icons/layout.gif) | scalable spaces.pdf | 2019-11-21 19:34 | 480K | |
![[ ]](/icons/layout.gif) | Milnor, betti numbers of real varieties.pdf | 2010-09-05 18:22 | 495K | |
![[ ]](/icons/layout.gif) | nabutovsky-rotman, morse09.pdf | 2010-09-07 15:48 | 513K | |
![[ ]](/icons/layout.gif) | Gromov, Large Riemannian Manifolds.pdf | 2010-09-05 18:22 | 518K | |
![[ ]](/icons/layout.gif) | Guth, Volume width inequality.pdf | 2018-12-07 12:54 | 555K | |
![[ ]](/icons/layout.gif) | CDMW JAMS.pdf | 2019-11-18 22:14 | 600K | |
![[ ]](/icons/layout.gif) | Guth, Recentg progress in quantitative topology.pdf | 2018-12-07 13:06 | 600K | |
![[ ]](/icons/layout.gif) | Katz, systolic freedom.pdf | 2010-09-05 18:22 | 634K | |
![[ ]](/icons/layout.gif) | Nabutovsky-Rotman JEMS.pdf | 2003-12-12 11:31 | 756K | |
![[ ]](/icons/layout.gif) | Liokumovich, Lishak, Nabutovsky, Rotman, .pdf | 2019-05-31 16:06 | 816K | |
![[ ]](/icons/layout.gif) | Guth, Minimax associated to Steenrod squares.pdf | 2018-12-07 12:53 | 1.0M | |
![[ ]](/icons/layout.gif) | CMW GAFA.pdf | 2019-11-18 22:13 | 1.0M | |
![[ ]](/icons/layout.gif) | Gromov on Yomdin.pdf | 2010-09-05 18:21 | 1.2M | |
![[ ]](/icons/layout.gif) | Cheeger, critical points.pdf | 2010-09-05 18:21 | 1.2M | |
![[ ]](/icons/layout.gif) | Babenko-Katz, ASENS_1998.pdf | 2010-09-05 18:21 | 2.7M | |
![[ ]](/icons/layout.gif) | LNM1834.pdf | 2010-09-05 18:22 | 2.8M | |
![[ ]](/icons/layout.gif) | Gromov, Dimension, non-linear spectra and width.pdf | 2010-09-05 18:22 | 6.6M | |
![[ ]](/icons/layout.gif) | NabW IHES.pdf | 2006-05-31 09:36 | 7.6M | |
|